C26H44O4Si — CID 10003826
(3R,4R,6S)-3-[(2E,4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyldeca-2,4,8-trienyl]-6-ethenyl-4-hydroxy-3-methyloxan-2-one (PubChem CID 10003826) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (3R,4R,6S)-3-[(2E,4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyldeca-2,4,8-trienyl]-6-ethenyl-4-hydroxy-3-methyloxan-2-one.
| Compound Name | (3R,4R,6S)-3-[(2E,4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyldeca-2,4,8-trienyl]-6-ethenyl-4-hydroxy-3-methyloxan-2-one |
|---|---|
| PubChem CID | 10003826 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (3R,4R,6S)-3-[(2E,4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyldeca-2,4,8-trienyl]-6-ethenyl-4-hydroxy-3-methyloxan-2-one |
| SMILES | C=C[C@@H]1C[C@@H](O)[C@@](C)(C/C=C(C)/C=C/CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C26H44O4Si/c1-10-22-18-23(27)26(7,24(28)30-22)17-16-20(2)14-12-11-13-15-21(3)19-29-31(8,9)25(4,5)6/h10,12,14-16,22-23,27H,1,11,13,17-19H2,2-9H3/b14-12+,20-16+,21-15+/t22-,23-,26-/m1/s1 |
| InChIKey | FXFLFWLKGQKAQL-ZGBSHBNDSA-N |
| XLogP | 6.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|