C25H44O4Si — CID 134957305
(3R,4S)-5-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]-4-hydroxy-3-methylpentan-2-one (PubChem CID 134957305) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is (3R,4S)-5-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]-4-hydroxy-3-methylpentan-2-one.
| Compound Name | (3R,4S)-5-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]-4-hydroxy-3-methylpentan-2-one |
|---|---|
| PubChem CID | 134957305 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (3R,4S)-5-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]-4-hydroxy-3-methylpentan-2-one |
| SMILES | C=C/C(C)=C/C[C@@H](C[C@@H]1C=CC[C@@H](C[C@H](O)[C@@H](C)C(C)=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O4Si/c1-10-18(2)14-15-23(29-30(8,9)25(5,6)7)16-21-12-11-13-22(28-21)17-24(27)19(3)20(4)26/h10-12,14,19,21-24,27H,1,13,15-17H2,2-9H3/b18-14+/t19-,21-,22-,23-,24-/m0/s1 |
| InChIKey | IBORYVYZRAHBCU-QTDQUAHTSA-N |
| XLogP | 5.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|