C35H56O6Si — CID 46197942
(1R,10S,12S,14E,16S,19R,20S,21S,22S)-6-hydroxy-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione (PubChem CID 46197942) has the molecular formula C35H56O6Si and a molecular weight of 600.91 g/mol. Its IUPAC name is (1R,10S,12S,14E,16S,19R,20S,21S,22S)-6-hydroxy-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione.
| Compound Name | (1R,10S,12S,14E,16S,19R,20S,21S,22S)-6-hydroxy-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione |
|---|---|
| PubChem CID | 46197942 |
| Molecular Formula | C35H56O6Si |
| Molecular Weight | 600.91 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | (1R,10S,12S,14E,16S,19R,20S,21S,22S)-6-hydroxy-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23-oxatricyclo[17.3.1.02,7]tricosa-2(7),5,14-triene-3,4,9-trione |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H]2CC[C@H](C)/C=C(\C)C[C@@H](C)C[C@H](C)C(=O)CC3=C(C(=O)C(=O)C(C)=C3O)[C@H](O2)[C@@H]1C |
| InChI | InChI=1S/C35H56O6Si/c1-11-42(12-2,13-3)41-34-24(8)29-15-14-20(4)16-21(5)17-22(6)18-23(7)28(36)19-27-30(35(40-29)26(34)10)33(39)32(38)25(9)31(27)37/h16,20,22-24,26,29,34-35,37H,11-15,17-19H2,1-10H3/b21-16+/t20-,22+,23-,24-,26+,29+,34-,35+/m0/s1 |
| InChIKey | MAGZKMNQKUJHBB-KZXBMRTJSA-N |
| XLogP | 8.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.91 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|