C29H40O6 — CID 175663391
(1R,10S,12S,14E,16S,19R,20R,21S,22R)-8,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione (PubChem CID 175663391) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is (1R,10S,12S,14E,16S,19R,20R,21S,22R)-8,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione.
| Compound Name | (1R,10S,12S,14E,16S,19R,20R,21S,22R)-8,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione |
|---|---|
| PubChem CID | 175663391 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | (1R,10S,12S,14E,16S,19R,20R,21S,22R)-8,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione |
| SMILES | CC1=c2oc3c(O)c2=C(C(=O)C1=O)[C@@H]1O[C@H](CC[C@H](C)/C=C(\C)C[C@@H](C)C[C@@H]3C)[C@H](C)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C29H40O6/c1-13-8-9-20-17(5)23(30)18(6)28(34-20)21-22-26(33)27(16(4)12-15(3)11-14(2)10-13)35-29(22)19(7)24(31)25(21)32/h10,13,15-18,20,23,28,30,33H,8-9,11-12H2,1-7H3/b14-10+/t13-,15+,16-,17-,18+,20+,23-,28+/m0/s1 |
| InChIKey | CPJMAOANEVGITI-VHMXKZKKSA-N |
| XLogP | 3.75 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|