C26H42O5 — CID 166636417
2,5,7-trihydroxy-6,8-dimethyl-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one (PubChem CID 166636417) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is 2,5,7-trihydroxy-6,8-dimethyl-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one.
| Compound Name | 2,5,7-trihydroxy-6,8-dimethyl-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one |
|---|---|
| PubChem CID | 166636417 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2,5,7-trihydroxy-6,8-dimethyl-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one |
| SMILES | CCCC/C=C/CCCCCCCCCC1(O)CC(=O)C2=C(O)C(C)C(O)C(C)=C2O1 |
| InChI | InChI=1S/C26H42O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(30)18-21(27)22-24(29)19(2)23(28)20(3)25(22)31-26/h7-8,19,23,28-30H,4-6,9-18H2,1-3H3/b8-7+ |
| InChIKey | VVZNRJGOKBDRJJ-BQYQJAHWSA-N |
| XLogP | 6.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|