C18H30O4 — CID 134687257
1-[(2R,4S,5S,6R)-4-hydroxy-6-[(1E,3S,4S,5E)-4-hydroxy-3,5-dimethylhepta-1,5-dienyl]-5-methyloxan-2-yl]propan-2-one (PubChem CID 134687257) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 1-[(2R,4S,5S,6R)-4-hydroxy-6-[(1E,3S,4S,5E)-4-hydroxy-3,5-dimethylhepta-1,5-dienyl]-5-methyloxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,4S,5S,6R)-4-hydroxy-6-[(1E,3S,4S,5E)-4-hydroxy-3,5-dimethylhepta-1,5-dienyl]-5-methyloxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 134687257 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-[(2R,4S,5S,6R)-4-hydroxy-6-[(1E,3S,4S,5E)-4-hydroxy-3,5-dimethylhepta-1,5-dienyl]-5-methyloxan-2-yl]propan-2-one |
| SMILES | C/C=C(\C)[C@@H](O)[C@@H](C)/C=C/[C@H]1O[C@@H](CC(C)=O)C[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C18H30O4/c1-6-11(2)18(21)12(3)7-8-17-14(5)16(20)10-15(22-17)9-13(4)19/h6-8,12,14-18,20-21H,9-10H2,1-5H3/b8-7+,11-6+/t12-,14-,15-,16-,17+,18+/m0/s1 |
| InChIKey | KZUSVZNJHFYUQX-SOZWEOSDSA-N |
| XLogP | 2.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|