C21H32O5 — CID 162924395
(4S)-2-[[(2R,3S,5R)-5-(2,6-dimethylhepta-1,5-dienyl)-3-hydroxy-3-methyloxolan-2-yl]methyl]-3,4-dihydroxycyclohex-2-en-1-one (PubChem CID 162924395) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (4S)-2-[[(2R,3S,5R)-5-(2,6-dimethylhepta-1,5-dienyl)-3-hydroxy-3-methyloxolan-2-yl]methyl]-3,4-dihydroxycyclohex-2-en-1-one.
| Compound Name | (4S)-2-[[(2R,3S,5R)-5-(2,6-dimethylhepta-1,5-dienyl)-3-hydroxy-3-methyloxolan-2-yl]methyl]-3,4-dihydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162924395 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (4S)-2-[[(2R,3S,5R)-5-(2,6-dimethylhepta-1,5-dienyl)-3-hydroxy-3-methyloxolan-2-yl]methyl]-3,4-dihydroxycyclohex-2-en-1-one |
| SMILES | CC(C)=CCCC(C)=C[C@H]1C[C@](C)(O)[C@@H](CC2=C(O)[C@@H](O)CCC2=O)O1 |
| InChI | InChI=1S/C21H32O5/c1-13(2)6-5-7-14(3)10-15-12-21(4,25)19(26-15)11-16-17(22)8-9-18(23)20(16)24/h6,10,15,18-19,23-25H,5,7-9,11-12H2,1-4H3/t15-,18-,19+,21-/m0/s1 |
| InChIKey | AGIQMOPLGHERJR-RMYQPGKMSA-N |
| XLogP | 3.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|