C35H54O5Si — CID 11296195
(1R,10S,12S,14E,16S,19R,20S,21S,22S)-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione (PubChem CID 11296195) has the molecular formula C35H54O5Si and a molecular weight of 582.90 g/mol. Its IUPAC name is (1R,10S,12S,14E,16S,19R,20S,21S,22S)-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione.
| Compound Name | (1R,10S,12S,14E,16S,19R,20S,21S,22S)-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione |
|---|---|
| PubChem CID | 11296195 |
| Molecular Formula | C35H54O5Si |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | (1R,10S,12S,14E,16S,19R,20S,21S,22S)-5,10,12,14,16,20,22-heptamethyl-21-triethylsilyloxy-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-2(7),5,8,14-tetraene-3,4-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H]2CC[C@H](C)/C=C(\C)C[C@@H](C)C[C@H](C)c3cc4c(o3)=C(C)C(=O)C(=O)C=4[C@H](O2)[C@@H]1C |
| InChI | InChI=1S/C35H54O5Si/c1-11-41(12-2,13-3)40-33-24(8)28-15-14-20(4)16-21(5)17-22(6)18-23(7)29-19-27-30(35(38-28)26(33)10)32(37)31(36)25(9)34(27)39-29/h16,19-20,22-24,26,28,33,35H,11-15,17-18H2,1-10H3/b21-16+/t20-,22+,23-,24-,26+,28+,33-,35+/m0/s1 |
| InChIKey | QPSXOQPKBWKJBM-CQJBPLSGSA-N |
| XLogP | 7.08 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|