C23H42O6Si — CID 11328198
tert-butyl (Z)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-3-oxodec-8-enoate (PubChem CID 11328198) has the molecular formula C23H42O6Si and a molecular weight of 442.67 g/mol. Its IUPAC name is tert-butyl (Z)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-3-oxodec-8-enoate.
| Compound Name | tert-butyl (Z)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-3-oxodec-8-enoate |
|---|---|
| PubChem CID | 11328198 |
| Molecular Formula | C23H42O6Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | tert-butyl (Z)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-3-oxodec-8-enoate |
| SMILES | CC(=O)OC/C=C(/C)CCC(CC(=O)CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O6Si/c1-17(13-14-27-18(2)24)11-12-20(29-30(9,10)23(6,7)8)15-19(25)16-21(26)28-22(3,4)5/h13,20H,11-12,14-16H2,1-10H3/b17-13- |
| InChIKey | IIDNUDCLSBGIQA-LGMDPLHJSA-N |
| XLogP | 5.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|