C22H40O4Si — CID 135013813
tert-butyl (1S,3Z,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-oxocyclonon-3-ene-1-carboxylate (PubChem CID 135013813) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is tert-butyl (1S,3Z,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-oxocyclonon-3-ene-1-carboxylate.
| Compound Name | tert-butyl (1S,3Z,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-oxocyclonon-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 135013813 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | tert-butyl (1S,3Z,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-oxocyclonon-3-ene-1-carboxylate |
| SMILES | C/C1=C/C[C@H](C(=O)OC(C)(C)C)C(=O)C(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H40O4Si/c1-15-11-13-17(20(24)25-21(3,4)5)19(23)16(2)18(14-12-15)26-27(9,10)22(6,7)8/h11,16-18H,12-14H2,1-10H3/b15-11-/t16?,17-,18-/m0/s1 |
| InChIKey | BUNVVQKDONYCOV-GJLCWQIASA-N |
| XLogP | 5.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|