C24H44O4Si — CID 46855392
tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxotetradeca-6,8-dienoate (PubChem CID 46855392) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxotetradeca-6,8-dienoate.
| Compound Name | tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxotetradeca-6,8-dienoate |
|---|---|
| PubChem CID | 46855392 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxotetradeca-6,8-dienoate |
| SMILES | CCCCC/C=C/C=C/C(CC(=O)CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O4Si/c1-10-11-12-13-14-15-16-17-21(28-29(8,9)24(5,6)7)18-20(25)19-22(26)27-23(2,3)4/h14-17,21H,10-13,18-19H2,1-9H3/b15-14+,17-16+ |
| InChIKey | CCNSJCCOSMVNDD-JLXBFWJWSA-N |
| XLogP | 6.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|