C21H36O3Si — CID 134853145
methyl 6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-triene-1-carboxylate (PubChem CID 134853145) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is methyl 6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-triene-1-carboxylate.
| Compound Name | methyl 6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-triene-1-carboxylate |
|---|---|
| PubChem CID | 134853145 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | methyl 6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-triene-1-carboxylate |
| SMILES | CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C(C(=O)OC)C1 |
| InChI | InChI=1S/C21H36O3Si/c1-8-9-10-15-19(24-25(6,7)21(2,3)4)17-13-11-12-14-18(16-17)20(22)23-5/h11-14,19H,8-10,15-16H2,1-7H3/t19-/m1/s1 |
| InChIKey | XOOFCUQOWKXTCU-LJQANCHMSA-N |
| XLogP | 5.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|