C25H46O4Si — CID 91229467
methyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-2,4-dienoate (PubChem CID 91229467) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is methyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-2,4-dienoate.
| Compound Name | methyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-2,4-dienoate |
|---|---|
| PubChem CID | 91229467 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | methyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-2,4-dienoate |
| SMILES | CCCCCCCCC(=O)[C@@H](CCCC=CC=CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O4Si/c1-8-9-10-11-13-16-19-22(26)23(29-30(6,7)25(2,3)4)20-17-14-12-15-18-21-24(27)28-5/h12,15,18,21,23H,8-11,13-14,16-17,19-20H2,1-7H3/t23-/m1/s1 |
| InChIKey | LFYMYHCFGBQKDV-HSZRJFAPSA-N |
| XLogP | 7.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|