C24H46O5Si2 — CID 59153449
methyl (7E,9E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundeca-7,9-dienoate (PubChem CID 59153449) has the molecular formula C24H46O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is methyl (7E,9E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundeca-7,9-dienoate.
| Compound Name | methyl (7E,9E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundeca-7,9-dienoate |
|---|---|
| PubChem CID | 59153449 |
| Molecular Formula | C24H46O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | methyl (7E,9E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-11-oxoundeca-7,9-dienoate |
| SMILES | COC(=O)CCCC(O[Si](C)(C)C(C)(C)C)C(/C=C/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O5Si2/c1-23(2,3)30(8,9)28-20(16-13-12-14-19-25)21(17-15-18-22(26)27-7)29-31(10,11)24(4,5)6/h12-14,16,19-21H,15,17-18H2,1-11H3/b14-12+,16-13+ |
| InChIKey | GMDWTOGVCLWVEN-ZAVUQCBESA-N |
| XLogP | 6.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|