C23H40O3Si — CID 91696822
methyl (4Z,7Z,10Z,12E)-14-trimethylsilyloxynonadeca-4,7,10,12-tetraenoate (PubChem CID 91696822) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is methyl (4Z,7Z,10Z,12E)-14-trimethylsilyloxynonadeca-4,7,10,12-tetraenoate.
| Compound Name | methyl (4Z,7Z,10Z,12E)-14-trimethylsilyloxynonadeca-4,7,10,12-tetraenoate |
|---|---|
| PubChem CID | 91696822 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | methyl (4Z,7Z,10Z,12E)-14-trimethylsilyloxynonadeca-4,7,10,12-tetraenoate |
| SMILES | CCCCCC(/C=C/C=C\C/C=C\C/C=C\CCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C23H40O3Si/c1-6-7-16-19-22(26-27(3,4)5)20-17-14-12-10-8-9-11-13-15-18-21-23(24)25-2/h8-9,12-15,17,20,22H,6-7,10-11,16,18-19,21H2,1-5H3/b9-8-,14-12-,15-13-,20-17+ |
| InChIKey | SLWBLUWALNMUKT-ATHPFHLYSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|