C25H50O4Si2 — CID 91749547
methyl (10E,12E)-9,14-bis(trimethylsilyloxy)octadeca-10,12-dienoate (PubChem CID 91749547) has the molecular formula C25H50O4Si2 and a molecular weight of 470.84 g/mol. Its IUPAC name is methyl (10E,12E)-9,14-bis(trimethylsilyloxy)octadeca-10,12-dienoate.
| Compound Name | methyl (10E,12E)-9,14-bis(trimethylsilyloxy)octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 91749547 |
| Molecular Formula | C25H50O4Si2 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | methyl (10E,12E)-9,14-bis(trimethylsilyloxy)octadeca-10,12-dienoate |
| SMILES | CCCCC(/C=C/C=C/C(CCCCCCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H50O4Si2/c1-9-10-18-23(28-30(3,4)5)20-16-17-21-24(29-31(6,7)8)19-14-12-11-13-15-22-25(26)27-2/h16-17,20-21,23-24H,9-15,18-19,22H2,1-8H3/b20-16+,21-17+ |
| InChIKey | OLXGSVOBBXQMEN-NWILIBCHSA-N |
| XLogP | 7.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|