C23H42O3Si — CID 134916264
ethyl 2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetate (PubChem CID 134916264) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is ethyl 2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 134916264 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | ethyl 2-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-yl]acetate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1CC=C[C@@H]1CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O3Si/c1-8-10-11-15-21(26-27(6,7)23(3,4)5)17-16-19-13-12-14-20(19)18-22(24)25-9-2/h12,14,16-17,19-21H,8-11,13,15,18H2,1-7H3/b17-16+/t19-,20-,21+/m1/s1 |
| InChIKey | WHAZOXJKFJPWGI-RTEPQJOYSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|