C18H36O3Si — CID 15921989
methyl (E)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-3-enoate (PubChem CID 15921989) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is methyl (E)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-3-enoate.
| Compound Name | methyl (E)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-3-enoate |
|---|---|
| PubChem CID | 15921989 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | methyl (E)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-3-enoate |
| SMILES | CCCCC(C)(/C=C/C(C)O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H36O3Si/c1-10-11-13-18(6,16(19)20-7)14-12-15(2)21-22(8,9)17(3,4)5/h12,14-15H,10-11,13H2,1-9H3/b14-12+ |
| InChIKey | VHQROWYYTPIJIV-WYMLVPIESA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|