C19H38O3Si — CID 15214222
methyl 2,2-dimethyl-4-tri(propan-2-yl)silyloxyhept-6-enoate (PubChem CID 15214222) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is methyl 2,2-dimethyl-4-tri(propan-2-yl)silyloxyhept-6-enoate.
| Compound Name | methyl 2,2-dimethyl-4-tri(propan-2-yl)silyloxyhept-6-enoate |
|---|---|
| PubChem CID | 15214222 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | methyl 2,2-dimethyl-4-tri(propan-2-yl)silyloxyhept-6-enoate |
| SMILES | C=CCC(CC(C)(C)C(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-11-12-17(13-19(8,9)18(20)21-10)22-23(14(2)3,15(4)5)16(6)7/h11,14-17H,1,12-13H2,2-10H3 |
| InChIKey | JYDDRFGMCNJYGM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|