C17H32O3Si — CID 101410326
methyl 3-ethenyl-2,2-dimethyl-4-triethylsilyloxyhex-5-enoate (PubChem CID 101410326) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is methyl 3-ethenyl-2,2-dimethyl-4-triethylsilyloxyhex-5-enoate.
| Compound Name | methyl 3-ethenyl-2,2-dimethyl-4-triethylsilyloxyhex-5-enoate |
|---|---|
| PubChem CID | 101410326 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | methyl 3-ethenyl-2,2-dimethyl-4-triethylsilyloxyhex-5-enoate |
| SMILES | C=CC(O[Si](CC)(CC)CC)C(C=C)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C17H32O3Si/c1-9-14(17(6,7)16(18)19-8)15(10-2)20-21(11-3,12-4)13-5/h9-10,14-15H,1-2,11-13H2,3-8H3 |
| InChIKey | HMNYMZKLCPCBNY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|