C25H46O4Si — CID 53362124
(E,4R)-4-[(1R,2S)-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoic acid (PubChem CID 53362124) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (E,4R)-4-[(1R,2S)-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoic acid.
| Compound Name | (E,4R)-4-[(1R,2S)-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoic acid |
|---|---|
| PubChem CID | 53362124 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (E,4R)-4-[(1R,2S)-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoic acid |
| SMILES | CC(C)[Si](O[C@H](/C=C/C(=O)O)[C@@H]1CCC[C@H]1/C=C/CCC[C@H](C)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H46O4Si/c1-18(2)30(19(3)4,20(5)6)29-24(16-17-25(27)28)23-15-11-14-22(23)13-10-8-9-12-21(7)26/h10,13,16-24,26H,8-9,11-12,14-15H2,1-7H3,(H,27,28)/b13-10+,17-16+/t21-,22+,23+,24+/m0/s1 |
| InChIKey | GGGFIPKPSVQKPH-UQHVKFQBSA-N |
| XLogP | 6.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|