C33H64O4Si2 — CID 135017968
ethyl (E,4R)-4-[(1R,2S)-2-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate (PubChem CID 135017968) has the molecular formula C33H64O4Si2 and a molecular weight of 581.04 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(1R,2S)-2-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(1R,2S)-2-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate |
|---|---|
| PubChem CID | 135017968 |
| Molecular Formula | C33H64O4Si2 |
| Molecular Weight | 581.04 g/mol |
| Exact Mass | 580.43 |
| IUPAC Name | ethyl (E,4R)-4-[(1R,2S)-2-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CCC[C@H]1/C=C/CCC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H64O4Si2/c1-14-35-32(34)24-23-31(37-39(25(2)3,26(4)5)27(6)7)30-22-18-21-29(30)20-17-15-16-19-28(8)36-38(12,13)33(9,10)11/h17,20,23-31H,14-16,18-19,21-22H2,1-13H3/b20-17+,24-23+/t28-,29-,30-,31-/m1/s1 |
| InChIKey | HZLQLMQXUABNFG-FGCHEXQYSA-N |
| XLogP | 10.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.04 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|