C23H48O4Si2 — CID 134866070
methyl (E,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnon-2-enoate (PubChem CID 134866070) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is methyl (E,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnon-2-enoate.
| Compound Name | methyl (E,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnon-2-enoate |
|---|---|
| PubChem CID | 134866070 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | methyl (E,5S,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnon-2-enoate |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](C/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O4Si2/c1-14-19(26-28(10,11)22(3,4)5)18(2)20(16-15-17-21(24)25-9)27-29(12,13)23(6,7)8/h15,17-20H,14,16H2,1-13H3/b17-15+/t18-,19+,20-/m0/s1 |
| InChIKey | RPWFJTIZXONGRA-VARDCOAOSA-N |
| XLogP | 6.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|