C28H54O5Si2 — CID 11341487
(E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoic acid (PubChem CID 11341487) has the molecular formula C28H54O5Si2 and a molecular weight of 526.91 g/mol. Its IUPAC name is (E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoic acid.
| Compound Name | (E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoic acid |
|---|---|
| PubChem CID | 11341487 |
| Molecular Formula | C28H54O5Si2 |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | (E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,6S)-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoic acid |
| SMILES | C[C@H](O)CCC/C=C/[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1[C@@H](/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O5Si2/c1-21(29)15-13-12-14-16-22-19-23(32-34(8,9)27(2,3)4)20-24(22)25(17-18-26(30)31)33-35(10,11)28(5,6)7/h14,16-18,21-25,29H,12-13,15,19-20H2,1-11H3,(H,30,31)/b16-14+,18-17+/t21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | VAPQBEGBACSEJA-ZUVJBVEQSA-N |
| XLogP | 7.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|