C18H36O3Si — CID 10520355
(E)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]undec-2-enoic acid (PubChem CID 10520355) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (E)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]undec-2-enoic acid.
| Compound Name | (E)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]undec-2-enoic acid |
|---|---|
| PubChem CID | 10520355 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (E)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]undec-2-enoic acid |
| SMILES | CCCCCCC(C/C=C/C(=O)O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-7-8-9-10-12-16(13-11-14-17(19)20)15-21-22(5,6)18(2,3)4/h11,14,16H,7-10,12-13,15H2,1-6H3,(H,19,20)/b14-11+ |
| InChIKey | IENQAJJLXFMSGU-SDNWHVSQSA-N |
| XLogP | 5.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|