C25H50O5Si2 — CID 10719742
ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate (PubChem CID 10719742) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate.
| Compound Name | ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate |
|---|---|
| PubChem CID | 10719742 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)[C@H](CC(=O)C(C)(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si2/c1-15-28-22(27)16-19(2)20(30-32(13,14)24(6,7)8)17-21(26)25(9,10)18-29-31(11,12)23(3,4)5/h16,20H,15,17-18H2,1-14H3/b19-16-/t20-/m0/s1 |
| InChIKey | HBZLZVQVUBKBPG-IZBXUMLASA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|