C24H48O5Si2 — CID 10576413
methyl (E,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate (PubChem CID 10576413) has the molecular formula C24H48O5Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is methyl (E,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate.
| Compound Name | methyl (E,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate |
|---|---|
| PubChem CID | 10576413 |
| Molecular Formula | C24H48O5Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | methyl (E,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,7-trimethyl-6-oxooct-2-enoate |
| SMILES | COC(=O)/C=C(\C)[C@H](CC(=O)C(C)(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O5Si2/c1-18(15-21(26)27-10)19(29-31(13,14)23(5,6)7)16-20(25)24(8,9)17-28-30(11,12)22(2,3)4/h15,19H,16-17H2,1-14H3/b18-15+/t19-/m0/s1 |
| InChIKey | DTYNHHOCSQPXKK-DGDHUYAWSA-N |
| XLogP | 6.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|