C17H32O5Si — CID 10545419
ethyl (Z,4S)-8-hydroxy-4-methoxy-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate (PubChem CID 10545419) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is ethyl (Z,4S)-8-hydroxy-4-methoxy-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate.
| Compound Name | ethyl (Z,4S)-8-hydroxy-4-methoxy-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate |
|---|---|
| PubChem CID | 10545419 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethyl (Z,4S)-8-hydroxy-4-methoxy-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate |
| SMILES | CCOC(=O)/C=C(\C[Si](C)(C)C)[C@H](CC(=O)C(C)(C)CO)OC |
| InChI | InChI=1S/C17H32O5Si/c1-8-22-16(20)9-13(11-23(5,6)7)14(21-4)10-15(19)17(2,3)12-18/h9,14,18H,8,10-12H2,1-7H3/b13-9+/t14-/m0/s1 |
| InChIKey | CEGPBJYSLSLOEA-SSUFTNFISA-N |
| XLogP | 2.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|