C17H30O4Si — CID 10592264
(6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,7-trimethyl-5,6-dihydro-2H-oxonine-4,9-dione (PubChem CID 10592264) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is (6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,7-trimethyl-5,6-dihydro-2H-oxonine-4,9-dione.
| Compound Name | (6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,7-trimethyl-5,6-dihydro-2H-oxonine-4,9-dione |
|---|---|
| PubChem CID | 10592264 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,7-trimethyl-5,6-dihydro-2H-oxonine-4,9-dione |
| SMILES | C/C1=C/C(=O)OCC(C)(C)C(=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O4Si/c1-12-9-15(19)20-11-17(5,6)14(18)10-13(12)21-22(7,8)16(2,3)4/h9,13H,10-11H2,1-8H3/b12-9-/t13-/m0/s1 |
| InChIKey | GRFAQSQGUJRWFE-SUIFULHWSA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|