C28H58O5Si3 — CID 10650487
ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate (PubChem CID 10650487) has the molecular formula C28H58O5Si3 and a molecular weight of 559.03 g/mol. Its IUPAC name is ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate.
| Compound Name | ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate |
|---|---|
| PubChem CID | 10650487 |
| Molecular Formula | C28H58O5Si3 |
| Molecular Weight | 559.03 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | ethyl (Z,4S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-dimethyl-6-oxo-3-(trimethylsilylmethyl)oct-2-enoate |
| SMILES | CCOC(=O)/C=C(\C[Si](C)(C)C)[C@H](CC(=O)C(C)(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O5Si3/c1-17-31-25(30)18-22(20-34(10,11)12)23(33-36(15,16)27(5,6)7)19-24(29)28(8,9)21-32-35(13,14)26(2,3)4/h18,23H,17,19-21H2,1-16H3/b22-18+/t23-/m0/s1 |
| InChIKey | VGOTZTGGWSBVMH-OILDRBDJSA-N |
| XLogP | 8.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.03 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|