C30H54O4Si — CID 44518070
(3E,5R,8R,10S,12R)-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-5-tri(propan-2-yl)silyloxy-1-oxacyclododec-3-ene-2,7-dione (PubChem CID 44518070) has the molecular formula C30H54O4Si and a molecular weight of 506.84 g/mol. Its IUPAC name is (3E,5R,8R,10S,12R)-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-5-tri(propan-2-yl)silyloxy-1-oxacyclododec-3-ene-2,7-dione.
| Compound Name | (3E,5R,8R,10S,12R)-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-5-tri(propan-2-yl)silyloxy-1-oxacyclododec-3-ene-2,7-dione |
|---|---|
| PubChem CID | 44518070 |
| Molecular Formula | C30H54O4Si |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | (3E,5R,8R,10S,12R)-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-5-tri(propan-2-yl)silyloxy-1-oxacyclododec-3-ene-2,7-dione |
| SMILES | C=C(CC)[C@H](C)C[C@H]1C[C@@H](C)C[C@@H](C)C(=O)C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)/C(C)=C/C(=O)O1 |
| InChI | InChI=1S/C30H54O4Si/c1-13-23(9)24(10)16-27-15-22(8)14-25(11)28(31)18-29(26(12)17-30(32)33-27)34-35(19(2)3,20(4)5)21(6)7/h17,19-22,24-25,27,29H,9,13-16,18H2,1-8,10-12H3/b26-17+/t22-,24+,25+,27+,29+/m0/s1 |
| InChIKey | GGPXPFLCEAQQHQ-BCBGWRIBSA-N |
| XLogP | 8.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|