C36H74O6Si3 — CID 101144068
ethyl (E,5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododec-2-enoate (PubChem CID 101144068) has the molecular formula C36H74O6Si3 and a molecular weight of 687.24 g/mol. Its IUPAC name is ethyl (E,5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododec-2-enoate.
| Compound Name | ethyl (E,5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododec-2-enoate |
|---|---|
| PubChem CID | 101144068 |
| Molecular Formula | C36H74O6Si3 |
| Molecular Weight | 687.24 g/mol |
| Exact Mass | 686.48 |
| IUPAC Name | ethyl (E,5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododec-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H74O6Si3/c1-21-39-30(37)24-22-23-27(2)31(42-45(19,20)35(10,11)12)28(3)32(38)36(13,14)29(41-44(17,18)34(7,8)9)25-26-40-43(15,16)33(4,5)6/h22,24,27-29,31H,21,23,25-26H2,1-20H3/b24-22+/t27-,28+,29-,31-/m0/s1 |
| InChIKey | XLSBRQVWFKRRKK-XRRAZBQISA-N |
| XLogP | 10.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.24 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|