C32H58O7Si2 — CID 134887037
(E)-3-[(2R,4E,6R,7R,8S,9R,10S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4,7,9-trimethyl-12,14-dioxo-1-oxacyclotetradec-4-en-2-yl]prop-2-enal (PubChem CID 134887037) has the molecular formula C32H58O7Si2 and a molecular weight of 610.98 g/mol. Its IUPAC name is (E)-3-[(2R,4E,6R,7R,8S,9R,10S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4,7,9-trimethyl-12,14-dioxo-1-oxacyclotetradec-4-en-2-yl]prop-2-enal.
| Compound Name | (E)-3-[(2R,4E,6R,7R,8S,9R,10S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4,7,9-trimethyl-12,14-dioxo-1-oxacyclotetradec-4-en-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 134887037 |
| Molecular Formula | C32H58O7Si2 |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | (E)-3-[(2R,4E,6R,7R,8S,9R,10S)-8,10-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4,7,9-trimethyl-12,14-dioxo-1-oxacyclotetradec-4-en-2-yl]prop-2-enal |
| SMILES | CO[C@@H]1/C=C(\C)C[C@H](/C=C/C=O)OC(=O)CC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C32H58O7Si2/c1-22-18-26(16-15-17-33)37-29(35)21-25(34)20-28(38-40(11,12)31(4,5)6)24(3)30(23(2)27(19-22)36-10)39-41(13,14)32(7,8)9/h15-17,19,23-24,26-28,30H,18,20-21H2,1-14H3/b16-15+,22-19+/t23-,24-,26+,27-,28+,30+/m1/s1 |
| InChIKey | MPTUWJYXGKRTPE-UAEYFEQISA-N |
| XLogP | 7.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|