C18H32O4Si — CID 10958772
[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-oxocyclohexen-1-yl]methyl acetate (PubChem CID 10958772) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-oxocyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-oxocyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10958772 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-oxocyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)C1(C)C |
| InChI | InChI=1S/C18H32O4Si/c1-12-14(11-21-13(2)19)18(6,7)16(20)10-15(12)22-23(8,9)17(3,4)5/h15H,10-11H2,1-9H3/t15-/m0/s1 |
| InChIKey | MPFDQPYICKQAEN-HNNXBMFYSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|