C18H34O4Si — CID 11057012
[(E,4R,5R)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] acetate (PubChem CID 11057012) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is [(E,4R,5R)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] acetate.
| Compound Name | [(E,4R,5R)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] acetate |
|---|---|
| PubChem CID | 11057012 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(E,4R,5R)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] acetate |
| SMILES | CCC(=O)[C@H](C)[C@@H](O[Si](CC)(CC)CC)/C(C)=C/COC(C)=O |
| InChI | InChI=1S/C18H34O4Si/c1-8-17(20)15(6)18(14(5)12-13-21-16(7)19)22-23(9-2,10-3)11-4/h12,15,18H,8-11,13H2,1-7H3/b14-12+/t15-,18-/m0/s1 |
| InChIKey | INZFRBFXQIPFRP-UINHPIIJSA-N |
| XLogP | 4.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|