C25H44O4Si — CID 135021660
[(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R)-4,8-dimethyl-7-oxo-4-triethylsilyloxynona-2,8-dienoate (PubChem CID 135021660) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is [(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R)-4,8-dimethyl-7-oxo-4-triethylsilyloxynona-2,8-dienoate.
| Compound Name | [(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R)-4,8-dimethyl-7-oxo-4-triethylsilyloxynona-2,8-dienoate |
|---|---|
| PubChem CID | 135021660 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | [(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R)-4,8-dimethyl-7-oxo-4-triethylsilyloxynona-2,8-dienoate |
| SMILES | C=CCC[C@H](C)[C@@H](C)OC(=O)/C=C/[C@@](C)(CCC(=O)C(=C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H44O4Si/c1-10-14-15-21(7)22(8)28-24(27)17-19-25(9,18-16-23(26)20(5)6)29-30(11-2,12-3)13-4/h10,17,19,21-22H,1,5,11-16,18H2,2-4,6-9H3/b19-17+/t21-,22+,25+/m0/s1 |
| InChIKey | CLJIBFSRAASKES-VAWWRJTMSA-N |
| XLogP | 6.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|