C25H46O4Si — CID 135021661
[(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R,7S)-7-hydroxy-4,8-dimethyl-4-triethylsilyloxynona-2,8-dienoate (PubChem CID 135021661) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is [(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R,7S)-7-hydroxy-4,8-dimethyl-4-triethylsilyloxynona-2,8-dienoate.
| Compound Name | [(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R,7S)-7-hydroxy-4,8-dimethyl-4-triethylsilyloxynona-2,8-dienoate |
|---|---|
| PubChem CID | 135021661 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | [(2R,3S)-3-methylhept-6-en-2-yl] (2E,4R,7S)-7-hydroxy-4,8-dimethyl-4-triethylsilyloxynona-2,8-dienoate |
| SMILES | C=CCC[C@H](C)[C@@H](C)OC(=O)/C=C/[C@@](C)(CC[C@H](O)C(=C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H46O4Si/c1-10-14-15-21(7)22(8)28-24(27)17-19-25(9,18-16-23(26)20(5)6)29-30(11-2,12-3)13-4/h10,17,19,21-23,26H,1,5,11-16,18H2,2-4,6-9H3/b19-17+/t21-,22+,23-,25+/m0/s1 |
| InChIKey | WSBUKPRHDKDOLO-IQAZTVGJSA-N |
| XLogP | 6.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|