C20H38O6Si — CID 11502268
ethyl (Z)-6-ethoxycarbonyloxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate (PubChem CID 11502268) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is ethyl (Z)-6-ethoxycarbonyloxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate.
| Compound Name | ethyl (Z)-6-ethoxycarbonyloxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate |
|---|---|
| PubChem CID | 11502268 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | ethyl (Z)-6-ethoxycarbonyloxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate |
| SMILES | CCOC(=O)OC/C=C(/C)C(O[Si](CC)(CC)CC)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C20H38O6Si/c1-9-23-18(21)20(7,8)17(26-27(11-3,12-4)13-5)16(6)14-15-25-19(22)24-10-2/h14,17H,9-13,15H2,1-8H3/b16-14- |
| InChIKey | WWXNDBFBSBBRMN-PEZBUJJGSA-N |
| XLogP | 5.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|