C20H40O5Si — CID 11111889
ethyl (E,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,6-dimethylhept-2-enoate (PubChem CID 11111889) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is ethyl (E,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,6-dimethylhept-2-enoate.
| Compound Name | ethyl (E,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,6-dimethylhept-2-enoate |
|---|---|
| PubChem CID | 11111889 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | ethyl (E,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-2,6-dimethylhept-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@](C)(COCOC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si/c1-10-24-18(21)17(2)12-11-13-20(6,14-23-16-22-7)15-25-26(8,9)19(3,4)5/h12H,10-11,13-16H2,1-9H3/b17-12+/t20-/m1/s1 |
| InChIKey | BCCDPMRPLAVBJP-KEWOFRHOSA-N |
| XLogP | 4.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|