C18H34O6Si — CID 11710543
ethyl (Z)-6-ethoxycarbonyloxy-4-methyl-3-triethylsilyloxyhex-4-enoate (PubChem CID 11710543) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is ethyl (Z)-6-ethoxycarbonyloxy-4-methyl-3-triethylsilyloxyhex-4-enoate.
| Compound Name | ethyl (Z)-6-ethoxycarbonyloxy-4-methyl-3-triethylsilyloxyhex-4-enoate |
|---|---|
| PubChem CID | 11710543 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | ethyl (Z)-6-ethoxycarbonyloxy-4-methyl-3-triethylsilyloxyhex-4-enoate |
| SMILES | CCOC(=O)CC(O[Si](CC)(CC)CC)/C(C)=C\COC(=O)OCC |
| InChI | InChI=1S/C18H34O6Si/c1-7-21-17(19)14-16(24-25(9-3,10-4)11-5)15(6)12-13-23-18(20)22-8-2/h12,16H,7-11,13-14H2,1-6H3/b15-12- |
| InChIKey | PXPQWWVEDHNZAA-QINSGFPZSA-N |
| XLogP | 4.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|