C24H46O5Si — CID 10599344
ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-(1-ethoxyethoxy)-5,9-dimethyldeca-4,8-dienoate (PubChem CID 10599344) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-(1-ethoxyethoxy)-5,9-dimethyldeca-4,8-dienoate.
| Compound Name | ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-(1-ethoxyethoxy)-5,9-dimethyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 10599344 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-(1-ethoxyethoxy)-5,9-dimethyldeca-4,8-dienoate |
| SMILES | CCOC(=O)CC(/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)OC(C)OCC |
| InChI | InChI=1S/C24H46O5Si/c1-11-26-21(5)29-22(17-23(25)27-12-2)16-19(3)14-13-15-20(4)18-28-30(9,10)24(6,7)8/h15-16,21-22H,11-14,17-18H2,1-10H3/b19-16+,20-15+ |
| InChIKey | YRGWCQHQMUURNL-RHBFVARBSA-N |
| XLogP | 6.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|