C20H38O5Si — CID 24938601
[(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (PubChem CID 24938601) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is [(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
| Compound Name | [(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
|---|---|
| PubChem CID | 24938601 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [(2R,5R)-5-(methoxymethoxy)hept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| SMILES | C=C[C@H](CC(=O)O[C@H](C)CC[C@H](C=C)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O5Si/c1-10-17(23-15-22-7)13-12-16(3)24-19(21)14-18(11-2)25-26(8,9)20(4,5)6/h10-11,16-18H,1-2,12-15H2,3-9H3/t16-,17+,18-/m1/s1 |
| InChIKey | OTSGKPROIWMQIX-FGTMMUONSA-N |
| XLogP | 4.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|