C17H34O6Si — CID 11013912
prop-2-enyl (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)butanoate (PubChem CID 11013912) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is prop-2-enyl (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)butanoate.
| Compound Name | prop-2-enyl (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)butanoate |
|---|---|
| PubChem CID | 11013912 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | prop-2-enyl (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)butanoate |
| SMILES | C=CCOC(=O)C[C@@H](CO[Si](C)(C)C(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C17H34O6Si/c1-8-9-21-16(18)12-15(22-14-20-11-10-19-5)13-23-24(6,7)17(2,3)4/h8,15H,1,9-14H2,2-7H3/t15-/m0/s1 |
| InChIKey | ZOVOYEVMOUWNAC-HNNXBMFYSA-N |
| XLogP | 3.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|