C21H38O5Si — CID 71474718
[(2R)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (PubChem CID 71474718) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is [(2R)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
| Compound Name | [(2R)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
|---|---|
| PubChem CID | 71474718 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [(2R)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| SMILES | C=C[C@H](CC(=O)O[C@H](C)C[C@@H]1OC(C)(C)O[C@H]1C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O5Si/c1-11-16(26-27(9,10)20(4,5)6)14-19(22)23-15(3)13-18-17(12-2)24-21(7,8)25-18/h11-12,15-18H,1-2,13-14H2,3-10H3/t15-,16-,17+,18+/m1/s1 |
| InChIKey | FTVLPSMDXCGUKO-BDXSIMOUSA-N |
| XLogP | 4.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|