C20H36O5Si — CID 139261291
[(2R)-5-acetyloxyhept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (PubChem CID 139261291) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is [(2R)-5-acetyloxyhept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
| Compound Name | [(2R)-5-acetyloxyhept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
|---|---|
| PubChem CID | 139261291 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(2R)-5-acetyloxyhept-6-en-2-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| SMILES | C=CC(CC[C@@H](C)OC(=O)C[C@@H](C=C)O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C20H36O5Si/c1-10-17(24-16(4)21)13-12-15(3)23-19(22)14-18(11-2)25-26(8,9)20(5,6)7/h10-11,15,17-18H,1-2,12-14H2,3-9H3/t15-,17?,18-/m1/s1 |
| InChIKey | ZACYDJJGQLAPOF-NEBWYHTOSA-N |
| XLogP | 4.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|