C19H36O5Si — CID 11603182
[(E,4R,5S)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] ethyl carbonate (PubChem CID 11603182) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is [(E,4R,5S)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] ethyl carbonate.
| Compound Name | [(E,4R,5S)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 11603182 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(E,4R,5S)-3,5-dimethyl-6-oxo-4-triethylsilyloxyoct-2-enyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C(\C)[C@H](O[Si](CC)(CC)CC)[C@H](C)C(=O)CC |
| InChI | InChI=1S/C19H36O5Si/c1-8-17(20)16(7)18(24-25(10-3,11-4)12-5)15(6)13-14-23-19(21)22-9-2/h13,16,18H,8-12,14H2,1-7H3/b15-13+/t16-,18+/m1/s1 |
| InChIKey | UWVGEIDHJNQZEL-RABPLZDSSA-N |
| XLogP | 5.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|