C29H56O6Si — CID 10007147
(6E,10E,12S,13R)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one (PubChem CID 10007147) has the molecular formula C29H56O6Si and a molecular weight of 528.85 g/mol. Its IUPAC name is (6E,10E,12S,13R)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one.
| Compound Name | (6E,10E,12S,13R)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one |
|---|---|
| PubChem CID | 10007147 |
| Molecular Formula | C29H56O6Si |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (6E,10E,12S,13R)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one |
| SMILES | COCOCC[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](/C=C(\C)CC/C=C(\C)CCCC(C)=O)OCOC |
| InChI | InChI=1S/C29H56O6Si/c1-24(14-12-16-26(3)30)13-11-15-25(2)21-28(34-23-32-8)27(17-19-33-22-31-7)18-20-35-36(9,10)29(4,5)6/h13,21,27-28H,11-12,14-20,22-23H2,1-10H3/b24-13+,25-21+/t27-,28-/m1/s1 |
| InChIKey | COOKHCBIRVRYJD-CXGWWZNDSA-N |
| XLogP | 7.45 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|