C22H44O6Si — CID 10094370
(E,6S,7R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,9-bis(methoxymethoxy)-4-methylnon-4-enal (PubChem CID 10094370) has the molecular formula C22H44O6Si and a molecular weight of 432.67 g/mol. Its IUPAC name is (E,6S,7R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,9-bis(methoxymethoxy)-4-methylnon-4-enal.
| Compound Name | (E,6S,7R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,9-bis(methoxymethoxy)-4-methylnon-4-enal |
|---|---|
| PubChem CID | 10094370 |
| Molecular Formula | C22H44O6Si |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (E,6S,7R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,9-bis(methoxymethoxy)-4-methylnon-4-enal |
| SMILES | COCOCC[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](/C=C(\C)CCC=O)OCOC |
| InChI | InChI=1S/C22H44O6Si/c1-19(10-9-13-23)16-21(27-18-25-6)20(11-14-26-17-24-5)12-15-28-29(7,8)22(2,3)4/h13,16,20-21H,9-12,14-15,17-18H2,1-8H3/b19-16+/t20-,21-/m1/s1 |
| InChIKey | IBLBPXMEWVHRAV-WIHYEFMVSA-N |
| XLogP | 4.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|