C27H52O6Si — CID 10413661
(4E,8E,10S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-bis(methoxymethoxy)-4,8-dimethyltrideca-4,8-dienal (PubChem CID 10413661) has the molecular formula C27H52O6Si and a molecular weight of 500.79 g/mol. Its IUPAC name is (4E,8E,10S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-bis(methoxymethoxy)-4,8-dimethyltrideca-4,8-dienal.
| Compound Name | (4E,8E,10S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-bis(methoxymethoxy)-4,8-dimethyltrideca-4,8-dienal |
|---|---|
| PubChem CID | 10413661 |
| Molecular Formula | C27H52O6Si |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | (4E,8E,10S,11R)-11-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-bis(methoxymethoxy)-4,8-dimethyltrideca-4,8-dienal |
| SMILES | COCOCC[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](/C=C(\C)CC/C=C(\C)CCC=O)OCOC |
| InChI | InChI=1S/C27H52O6Si/c1-23(14-11-17-28)12-10-13-24(2)20-26(32-22-30-7)25(15-18-31-21-29-6)16-19-33-34(8,9)27(3,4)5/h12,17,20,25-26H,10-11,13-16,18-19,21-22H2,1-9H3/b23-12+,24-20+/t25-,26-/m1/s1 |
| InChIKey | KLCPRGWDMYIMKI-JVDAOGLFSA-N |
| XLogP | 6.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|