C27H53IO5Si — CID 10326431
tert-butyl-[(3R,4S,5E,9E)-13-iodo-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6,10-dimethyltrideca-5,9-dienoxy]-dimethylsilane (PubChem CID 10326431) has the molecular formula C27H53IO5Si and a molecular weight of 612.71 g/mol. Its IUPAC name is tert-butyl-[(3R,4S,5E,9E)-13-iodo-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6,10-dimethyltrideca-5,9-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4S,5E,9E)-13-iodo-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6,10-dimethyltrideca-5,9-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10326431 |
| Molecular Formula | C27H53IO5Si |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | tert-butyl-[(3R,4S,5E,9E)-13-iodo-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6,10-dimethyltrideca-5,9-dienoxy]-dimethylsilane |
| SMILES | COCOCC[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](/C=C(\C)CC/C=C(\C)CCCI)OCOC |
| InChI | InChI=1S/C27H53IO5Si/c1-23(14-11-17-28)12-10-13-24(2)20-26(32-22-30-7)25(15-18-31-21-29-6)16-19-33-34(8,9)27(3,4)5/h12,20,25-26H,10-11,13-19,21-22H2,1-9H3/b23-12+,24-20+/t25-,26-/m1/s1 |
| InChIKey | VZBMRSXGNXTZCK-JVDAOGLFSA-N |
| XLogP | 7.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|